C12H25NO4 — CID 114989592
2-[bis(2-methoxyethyl)amino]-2-ethylbutanoic acid (PubChem CID 114989592) has the molecular formula C12H25NO4 and a molecular weight of 247.33 g/mol. Its IUPAC name is 2-[bis(2-methoxyethyl)amino]-2-ethylbutanoic acid.
| Compound Name | 2-[bis(2-methoxyethyl)amino]-2-ethylbutanoic acid |
|---|---|
| PubChem CID | 114989592 |
| Molecular Formula | C12H25NO4 |
| Molecular Weight | 247.33 g/mol |
| Exact Mass | 247.18 |
| IUPAC Name | 2-[bis(2-methoxyethyl)amino]-2-ethylbutanoic acid |
| SMILES | CCC(CC)(C(=O)O)N(CCOC)CCOC |
| InChI | InChI=1S/C12H25NO4/c1-5-12(6-2,11(14)15)13(7-9-16-3)8-10-17-4/h5-10H2,1-4H3,(H,14,15) |
| InChIKey | KNVFIFPYKBTYEA-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.33 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |