About 4-[butan-2-yl(2-methoxyethyl)amino]-2,2-dimethylbutanoic acid
4-[butan-2-yl(2-methoxyethyl)amino]-2,2-dimethylbutanoic acid (PubChem CID 65247850) has the molecular formula C13H27NO3
and a molecular weight of 245.36 g/mol. Its IUPAC name is 4-[butan-2-yl(2-methoxyethyl)amino]-2,2-dimethylbutanoic acid.
Analyze 4-[butan-2-yl(2-methoxyethyl)amino]-2,2-dimethylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[butan-2-yl(2-methoxyethyl)amino]-2,2-dimethylbutanoic acid?
The IUPAC name of 4-[butan-2-yl(2-methoxyethyl)amino]-2,2-dimethylbutanoic acid (CID 65247850) is 4-[butan-2-yl(2-methoxyethyl)amino]-2,2-dimethylbutanoic acid.
What is the SMILES notation for 4-[butan-2-yl(2-methoxyethyl)amino]-2,2-dimethylbutanoic acid?
The canonical SMILES for 4-[butan-2-yl(2-methoxyethyl)amino]-2,2-dimethylbutanoic acid is CCC(C)N(CCOC)CCC(C)(C)C(=O)O.
What is the InChIKey of 4-[butan-2-yl(2-methoxyethyl)amino]-2,2-dimethylbutanoic acid?
The InChIKey is JQDYZSOTGLXBKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27NO3/c1-6-11(2)14(9-10-17-5)8-7-13(3,4)12(15)16/h11H,6-10H2,1-5H3,(H,15,16).
What are the key properties of 4-[butan-2-yl(2-methoxyethyl)amino]-2,2-dimethylbutanoic acid?
4-[butan-2-yl(2-methoxyethyl)amino]-2,2-dimethylbutanoic acid has a molecular weight of 245.36 g/mol, XLogP of 2.23, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[butan-2-yl(2-methoxyethyl)amino]-2,2-dimethylbutanoic acid is sourced from PubChem (CID 65247850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).