C16H36N2O2 — CID 64828176
5-[butan-2-yl(2-methoxyethyl)amino]-2-methyl-2-(propan-2-ylamino)pentan-1-ol (PubChem CID 64828176) has the molecular formula C16H36N2O2 and a molecular weight of 288.48 g/mol. Its IUPAC name is 5-[butan-2-yl(2-methoxyethyl)amino]-2-methyl-2-(propan-2-ylamino)pentan-1-ol.
| Compound Name | 5-[butan-2-yl(2-methoxyethyl)amino]-2-methyl-2-(propan-2-ylamino)pentan-1-ol |
|---|---|
| PubChem CID | 64828176 |
| Molecular Formula | C16H36N2O2 |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.28 |
| IUPAC Name | 5-[butan-2-yl(2-methoxyethyl)amino]-2-methyl-2-(propan-2-ylamino)pentan-1-ol |
| SMILES | CCC(C)N(CCCC(C)(CO)NC(C)C)CCOC |
| InChI | InChI=1S/C16H36N2O2/c1-7-15(4)18(11-12-20-6)10-8-9-16(5,13-19)17-14(2)3/h14-15,17,19H,7-13H2,1-6H3 |
| InChIKey | VOQPVIWEDWOYOR-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |