C16H36N2O — CID 64797449
2-methyl-2-(propan-2-ylamino)-6-[propan-2-yl(propyl)amino]hexan-1-ol (PubChem CID 64797449) has the molecular formula C16H36N2O and a molecular weight of 272.48 g/mol. Its IUPAC name is 2-methyl-2-(propan-2-ylamino)-6-[propan-2-yl(propyl)amino]hexan-1-ol.
| Compound Name | 2-methyl-2-(propan-2-ylamino)-6-[propan-2-yl(propyl)amino]hexan-1-ol |
|---|---|
| PubChem CID | 64797449 |
| Molecular Formula | C16H36N2O |
| Molecular Weight | 272.48 g/mol |
| Exact Mass | 272.28 |
| IUPAC Name | 2-methyl-2-(propan-2-ylamino)-6-[propan-2-yl(propyl)amino]hexan-1-ol |
| SMILES | CCCN(CCCCC(C)(CO)NC(C)C)C(C)C |
| InChI | InChI=1S/C16H36N2O/c1-7-11-18(15(4)5)12-9-8-10-16(6,13-19)17-14(2)3/h14-15,17,19H,7-13H2,1-6H3 |
| InChIKey | ZGMZKLLFNSVXDU-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.48 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|