C16H36N2O2 — CID 64827562
4-[butan-2-yl(2-methoxyethyl)amino]-2-methyl-2-(propan-2-ylamino)pentan-1-ol (PubChem CID 64827562) has the molecular formula C16H36N2O2 and a molecular weight of 288.48 g/mol. Its IUPAC name is 4-[butan-2-yl(2-methoxyethyl)amino]-2-methyl-2-(propan-2-ylamino)pentan-1-ol.
| Compound Name | 4-[butan-2-yl(2-methoxyethyl)amino]-2-methyl-2-(propan-2-ylamino)pentan-1-ol |
|---|---|
| PubChem CID | 64827562 |
| Molecular Formula | C16H36N2O2 |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.28 |
| IUPAC Name | 4-[butan-2-yl(2-methoxyethyl)amino]-2-methyl-2-(propan-2-ylamino)pentan-1-ol |
| SMILES | CCC(C)N(CCOC)C(C)CC(C)(CO)NC(C)C |
| InChI | InChI=1S/C16H36N2O2/c1-8-14(4)18(9-10-20-7)15(5)11-16(6,12-19)17-13(2)3/h13-15,17,19H,8-12H2,1-7H3 |
| InChIKey | MZXLMXUNQGACNN-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |