C14H32N2O — CID 64795544
2-methyl-4-[methyl(pentan-3-yl)amino]-2-(propan-2-ylamino)butan-1-ol (PubChem CID 64795544) has the molecular formula C14H32N2O and a molecular weight of 244.42 g/mol. Its IUPAC name is 2-methyl-4-[methyl(pentan-3-yl)amino]-2-(propan-2-ylamino)butan-1-ol.
| Compound Name | 2-methyl-4-[methyl(pentan-3-yl)amino]-2-(propan-2-ylamino)butan-1-ol |
|---|---|
| PubChem CID | 64795544 |
| Molecular Formula | C14H32N2O |
| Molecular Weight | 244.42 g/mol |
| Exact Mass | 244.25 |
| IUPAC Name | 2-methyl-4-[methyl(pentan-3-yl)amino]-2-(propan-2-ylamino)butan-1-ol |
| SMILES | CCC(CC)N(C)CCC(C)(CO)NC(C)C |
| InChI | InChI=1S/C14H32N2O/c1-7-13(8-2)16(6)10-9-14(5,11-17)15-12(3)4/h12-13,15,17H,7-11H2,1-6H3 |
| InChIKey | MEASKGJLZRJGNW-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.42 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |