C14H32N2O3 — CID 64825594
5-[2-methoxyethyl(1-methoxypropan-2-yl)amino]-2-methyl-2-(methylamino)pentan-1-ol (PubChem CID 64825594) has the molecular formula C14H32N2O3 and a molecular weight of 276.42 g/mol. Its IUPAC name is 5-[2-methoxyethyl(1-methoxypropan-2-yl)amino]-2-methyl-2-(methylamino)pentan-1-ol.
| Compound Name | 5-[2-methoxyethyl(1-methoxypropan-2-yl)amino]-2-methyl-2-(methylamino)pentan-1-ol |
|---|---|
| PubChem CID | 64825594 |
| Molecular Formula | C14H32N2O3 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.24 |
| IUPAC Name | 5-[2-methoxyethyl(1-methoxypropan-2-yl)amino]-2-methyl-2-(methylamino)pentan-1-ol |
| SMILES | CNC(C)(CO)CCCN(CCOC)C(C)COC |
| InChI | InChI=1S/C14H32N2O3/c1-13(11-19-5)16(9-10-18-4)8-6-7-14(2,12-17)15-3/h13,15,17H,6-12H2,1-5H3 |
| InChIKey | ONSMLNPXCCEXST-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |