C12H25NO2 — CID 65254735
5-[butan-2-yl(methyl)amino]-2,2-dimethylpentanoic acid (PubChem CID 65254735) has the molecular formula C12H25NO2 and a molecular weight of 215.34 g/mol. Its IUPAC name is 5-[butan-2-yl(methyl)amino]-2,2-dimethylpentanoic acid.
| Compound Name | 5-[butan-2-yl(methyl)amino]-2,2-dimethylpentanoic acid |
|---|---|
| PubChem CID | 65254735 |
| Molecular Formula | C12H25NO2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | 5-[butan-2-yl(methyl)amino]-2,2-dimethylpentanoic acid |
| SMILES | CCC(C)N(C)CCCC(C)(C)C(=O)O |
| InChI | InChI=1S/C12H25NO2/c1-6-10(2)13(5)9-7-8-12(3,4)11(14)15/h10H,6-9H2,1-5H3,(H,14,15) |
| InChIKey | YMARNXYQVIBFPH-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |