C14H29NO2 — CID 106713917
2,2-dimethyl-6-[methyl(3-methylbutan-2-yl)amino]hexanoic acid (PubChem CID 106713917) has the molecular formula C14H29NO2 and a molecular weight of 243.39 g/mol. Its IUPAC name is 2,2-dimethyl-6-[methyl(3-methylbutan-2-yl)amino]hexanoic acid.
| Compound Name | 2,2-dimethyl-6-[methyl(3-methylbutan-2-yl)amino]hexanoic acid |
|---|---|
| PubChem CID | 106713917 |
| Molecular Formula | C14H29NO2 |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.22 |
| IUPAC Name | 2,2-dimethyl-6-[methyl(3-methylbutan-2-yl)amino]hexanoic acid |
| SMILES | CC(C)C(C)N(C)CCCCC(C)(C)C(=O)O |
| InChI | InChI=1S/C14H29NO2/c1-11(2)12(3)15(6)10-8-7-9-14(4,5)13(16)17/h11-12H,7-10H2,1-6H3,(H,16,17) |
| InChIKey | ZYDXQFIFYLJJNP-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|