C13H27NO2 — CID 62270300
2-methyl-2-[[methyl(3-methylbutan-2-yl)amino]methyl]pentanoic acid (PubChem CID 62270300) has the molecular formula C13H27NO2 and a molecular weight of 229.36 g/mol. Its IUPAC name is 2-methyl-2-[[methyl(3-methylbutan-2-yl)amino]methyl]pentanoic acid.
| Compound Name | 2-methyl-2-[[methyl(3-methylbutan-2-yl)amino]methyl]pentanoic acid |
|---|---|
| PubChem CID | 62270300 |
| Molecular Formula | C13H27NO2 |
| Molecular Weight | 229.36 g/mol |
| Exact Mass | 229.20 |
| IUPAC Name | 2-methyl-2-[[methyl(3-methylbutan-2-yl)amino]methyl]pentanoic acid |
| SMILES | CCCC(C)(CN(C)C(C)C(C)C)C(=O)O |
| InChI | InChI=1S/C13H27NO2/c1-7-8-13(5,12(15)16)9-14(6)11(4)10(2)3/h10-11H,7-9H2,1-6H3,(H,15,16) |
| InChIKey | LSLPIKHLFOFBFW-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.36 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |