C15H31NO2 — CID 65254635
5-[bis(2-methylpropyl)amino]-2,2-dimethylpentanoic acid (PubChem CID 65254635) has the molecular formula C15H31NO2 and a molecular weight of 257.42 g/mol. Its IUPAC name is 5-[bis(2-methylpropyl)amino]-2,2-dimethylpentanoic acid.
| Compound Name | 5-[bis(2-methylpropyl)amino]-2,2-dimethylpentanoic acid |
|---|---|
| PubChem CID | 65254635 |
| Molecular Formula | C15H31NO2 |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.24 |
| IUPAC Name | 5-[bis(2-methylpropyl)amino]-2,2-dimethylpentanoic acid |
| SMILES | CC(C)CN(CCCC(C)(C)C(=O)O)CC(C)C |
| InChI | InChI=1S/C15H31NO2/c1-12(2)10-16(11-13(3)4)9-7-8-15(5,6)14(17)18/h12-13H,7-11H2,1-6H3,(H,17,18) |
| InChIKey | ATXOOQWMCRQOOV-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |