C15H32N2S — CID 65260345
5-[bis(2-methylpropyl)amino]-2,2-dimethylpentanethioamide (PubChem CID 65260345) has the molecular formula C15H32N2S and a molecular weight of 272.50 g/mol. Its IUPAC name is 5-[bis(2-methylpropyl)amino]-2,2-dimethylpentanethioamide.
| Compound Name | 5-[bis(2-methylpropyl)amino]-2,2-dimethylpentanethioamide |
|---|---|
| PubChem CID | 65260345 |
| Molecular Formula | C15H32N2S |
| Molecular Weight | 272.50 g/mol |
| Exact Mass | 272.23 |
| IUPAC Name | 5-[bis(2-methylpropyl)amino]-2,2-dimethylpentanethioamide |
| SMILES | CC(C)CN(CCCC(C)(C)C(N)=S)CC(C)C |
| InChI | InChI=1S/C15H32N2S/c1-12(2)10-17(11-13(3)4)9-7-8-15(5,6)14(16)18/h12-13H,7-11H2,1-6H3,(H2,16,18) |
| InChIKey | FMKQGWHUEMZJBU-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.50 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|