C12H23F3N2S — CID 65259742
2,2-dimethyl-5-[propyl(2,2,2-trifluoroethyl)amino]pentanethioamide (PubChem CID 65259742) has the molecular formula C12H23F3N2S and a molecular weight of 284.39 g/mol. Its IUPAC name is 2,2-dimethyl-5-[propyl(2,2,2-trifluoroethyl)amino]pentanethioamide.
| Compound Name | 2,2-dimethyl-5-[propyl(2,2,2-trifluoroethyl)amino]pentanethioamide |
|---|---|
| PubChem CID | 65259742 |
| Molecular Formula | C12H23F3N2S |
| Molecular Weight | 284.39 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 2,2-dimethyl-5-[propyl(2,2,2-trifluoroethyl)amino]pentanethioamide |
| SMILES | CCCN(CCCC(C)(C)C(N)=S)CC(F)(F)F |
| InChI | InChI=1S/C12H23F3N2S/c1-4-7-17(9-12(13,14)15)8-5-6-11(2,3)10(16)18/h4-9H2,1-3H3,(H2,16,18) |
| InChIKey | MVFAXWIEGRSYHU-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.39 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|