C14H29F3N2O — CID 64825496
2-(ethylamino)-2-methyl-6-[propyl(2,2,2-trifluoroethyl)amino]hexan-1-ol (PubChem CID 64825496) has the molecular formula C14H29F3N2O and a molecular weight of 298.39 g/mol. Its IUPAC name is 2-(ethylamino)-2-methyl-6-[propyl(2,2,2-trifluoroethyl)amino]hexan-1-ol.
| Compound Name | 2-(ethylamino)-2-methyl-6-[propyl(2,2,2-trifluoroethyl)amino]hexan-1-ol |
|---|---|
| PubChem CID | 64825496 |
| Molecular Formula | C14H29F3N2O |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.22 |
| IUPAC Name | 2-(ethylamino)-2-methyl-6-[propyl(2,2,2-trifluoroethyl)amino]hexan-1-ol |
| SMILES | CCCN(CCCCC(C)(CO)NCC)CC(F)(F)F |
| InChI | InChI=1S/C14H29F3N2O/c1-4-9-19(11-14(15,16)17)10-7-6-8-13(3,12-20)18-5-2/h18,20H,4-12H2,1-3H3 |
| InChIKey | NBFFAQVNAOLMAV-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|