C13H24F3NO2 — CID 106713942
2,2-dimethyl-6-[propyl(2,2,2-trifluoroethyl)amino]hexanoic acid (PubChem CID 106713942) has the molecular formula C13H24F3NO2 and a molecular weight of 283.33 g/mol. Its IUPAC name is 2,2-dimethyl-6-[propyl(2,2,2-trifluoroethyl)amino]hexanoic acid.
| Compound Name | 2,2-dimethyl-6-[propyl(2,2,2-trifluoroethyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 106713942 |
| Molecular Formula | C13H24F3NO2 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | 2,2-dimethyl-6-[propyl(2,2,2-trifluoroethyl)amino]hexanoic acid |
| SMILES | CCCN(CCCCC(C)(C)C(=O)O)CC(F)(F)F |
| InChI | InChI=1S/C13H24F3NO2/c1-4-8-17(10-13(14,15)16)9-6-5-7-12(2,3)11(18)19/h4-10H2,1-3H3,(H,18,19) |
| InChIKey | ATXKDIDSWOPVCH-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|