C14H26F3NO2 — CID 79266101
2-[decyl(2,2,2-trifluoroethyl)amino]acetic acid (PubChem CID 79266101) has the molecular formula C14H26F3NO2 and a molecular weight of 297.36 g/mol. Its IUPAC name is 2-[decyl(2,2,2-trifluoroethyl)amino]acetic acid.
| Compound Name | 2-[decyl(2,2,2-trifluoroethyl)amino]acetic acid |
|---|---|
| PubChem CID | 79266101 |
| Molecular Formula | C14H26F3NO2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | 2-[decyl(2,2,2-trifluoroethyl)amino]acetic acid |
| SMILES | CCCCCCCCCCN(CC(=O)O)CC(F)(F)F |
| InChI | InChI=1S/C14H26F3NO2/c1-2-3-4-5-6-7-8-9-10-18(11-13(19)20)12-14(15,16)17/h2-12H2,1H3,(H,19,20) |
| InChIKey | KJVCEHQIOMVYHW-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|