C10H18F3NO3 — CID 107704620
2-[6-hydroxyhexyl(2,2,2-trifluoroethyl)amino]acetic acid (PubChem CID 107704620) has the molecular formula C10H18F3NO3 and a molecular weight of 257.25 g/mol. Its IUPAC name is 2-[6-hydroxyhexyl(2,2,2-trifluoroethyl)amino]acetic acid.
| Compound Name | 2-[6-hydroxyhexyl(2,2,2-trifluoroethyl)amino]acetic acid |
|---|---|
| PubChem CID | 107704620 |
| Molecular Formula | C10H18F3NO3 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 2-[6-hydroxyhexyl(2,2,2-trifluoroethyl)amino]acetic acid |
| SMILES | O=C(O)CN(CCCCCCO)CC(F)(F)F |
| InChI | InChI=1S/C10H18F3NO3/c11-10(12,13)8-14(7-9(16)17)5-3-1-2-4-6-15/h15H,1-8H2,(H,16,17) |
| InChIKey | JZJAOARQOUHJRD-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|