C10H17F3N2O4 — CID 107485886
4-[[2-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]acetyl]amino]butanoic acid (PubChem CID 107485886) has the molecular formula C10H17F3N2O4 and a molecular weight of 286.25 g/mol. Its IUPAC name is 4-[[2-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]acetyl]amino]butanoic acid.
| Compound Name | 4-[[2-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]acetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 107485886 |
| Molecular Formula | C10H17F3N2O4 |
| Molecular Weight | 286.25 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 4-[[2-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]acetyl]amino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)CN(CCO)CC(F)(F)F |
| InChI | InChI=1S/C10H17F3N2O4/c11-10(12,13)7-15(4-5-16)6-8(17)14-3-1-2-9(18)19/h16H,1-7H2,(H,14,17)(H,18,19) |
| InChIKey | XDQQZFFSHXBWRF-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.25 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|