C12H21F3N2O4 — CID 103864941
ethyl 4-[[2-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]acetyl]amino]butanoate (PubChem CID 103864941) has the molecular formula C12H21F3N2O4 and a molecular weight of 314.30 g/mol. Its IUPAC name is ethyl 4-[[2-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]acetyl]amino]butanoate.
| Compound Name | ethyl 4-[[2-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]acetyl]amino]butanoate |
|---|---|
| PubChem CID | 103864941 |
| Molecular Formula | C12H21F3N2O4 |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | ethyl 4-[[2-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]acetyl]amino]butanoate |
| SMILES | CCOC(=O)CCCNC(=O)CN(CCO)CC(F)(F)F |
| InChI | InChI=1S/C12H21F3N2O4/c1-2-21-11(20)4-3-5-16-10(19)8-17(6-7-18)9-12(13,14)15/h18H,2-9H2,1H3,(H,16,19) |
| InChIKey | OHNIVRCDKVKIOE-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|