C9H16F3NO3 — CID 79258337
2-[3-ethoxypropyl(2,2,2-trifluoroethyl)amino]acetic acid (PubChem CID 79258337) has the molecular formula C9H16F3NO3 and a molecular weight of 243.22 g/mol. Its IUPAC name is 2-[3-ethoxypropyl(2,2,2-trifluoroethyl)amino]acetic acid.
| Compound Name | 2-[3-ethoxypropyl(2,2,2-trifluoroethyl)amino]acetic acid |
|---|---|
| PubChem CID | 79258337 |
| Molecular Formula | C9H16F3NO3 |
| Molecular Weight | 243.22 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 2-[3-ethoxypropyl(2,2,2-trifluoroethyl)amino]acetic acid |
| SMILES | CCOCCCN(CC(=O)O)CC(F)(F)F |
| InChI | InChI=1S/C9H16F3NO3/c1-2-16-5-3-4-13(6-8(14)15)7-9(10,11)12/h2-7H2,1H3,(H,14,15) |
| InChIKey | VWRUBHVWUOMNOL-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.22 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|