C14H27F3N2O2 — CID 65269422
3-amino-N-(3-ethoxypropyl)-2,2,3-trimethyl-N-(2,2,2-trifluoroethyl)butanamide (PubChem CID 65269422) has the molecular formula C14H27F3N2O2 and a molecular weight of 312.38 g/mol. Its IUPAC name is 3-amino-N-(3-ethoxypropyl)-2,2,3-trimethyl-N-(2,2,2-trifluoroethyl)butanamide.
| Compound Name | 3-amino-N-(3-ethoxypropyl)-2,2,3-trimethyl-N-(2,2,2-trifluoroethyl)butanamide |
|---|---|
| PubChem CID | 65269422 |
| Molecular Formula | C14H27F3N2O2 |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | 3-amino-N-(3-ethoxypropyl)-2,2,3-trimethyl-N-(2,2,2-trifluoroethyl)butanamide |
| SMILES | CCOCCCN(CC(F)(F)F)C(=O)C(C)(C)C(C)(C)N |
| InChI | InChI=1S/C14H27F3N2O2/c1-6-21-9-7-8-19(10-14(15,16)17)11(20)12(2,3)13(4,5)18/h6-10,18H2,1-5H3 |
| InChIKey | WMURJLBSUVMKPP-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|