C12H23F3N2O3 — CID 62474145
2-amino-N-(3-ethoxypropyl)-4-methoxy-N-(2,2,2-trifluoroethyl)butanamide (PubChem CID 62474145) has the molecular formula C12H23F3N2O3 and a molecular weight of 300.32 g/mol. Its IUPAC name is 2-amino-N-(3-ethoxypropyl)-4-methoxy-N-(2,2,2-trifluoroethyl)butanamide.
| Compound Name | 2-amino-N-(3-ethoxypropyl)-4-methoxy-N-(2,2,2-trifluoroethyl)butanamide |
|---|---|
| PubChem CID | 62474145 |
| Molecular Formula | C12H23F3N2O3 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | 2-amino-N-(3-ethoxypropyl)-4-methoxy-N-(2,2,2-trifluoroethyl)butanamide |
| SMILES | CCOCCCN(CC(F)(F)F)C(=O)C(N)CCOC |
| InChI | InChI=1S/C12H23F3N2O3/c1-3-20-7-4-6-17(9-12(13,14)15)11(18)10(16)5-8-19-2/h10H,3-9,16H2,1-2H3 |
| InChIKey | KPHLHWOJDWAAFD-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|