C10H19F3N2O — CID 79024297
(2S)-2-amino-N-butyl-N-(2,2,2-trifluoroethyl)butanamide (PubChem CID 79024297) has the molecular formula C10H19F3N2O and a molecular weight of 240.27 g/mol. Its IUPAC name is (2S)-2-amino-N-butyl-N-(2,2,2-trifluoroethyl)butanamide.
| Compound Name | (2S)-2-amino-N-butyl-N-(2,2,2-trifluoroethyl)butanamide |
|---|---|
| PubChem CID | 79024297 |
| Molecular Formula | C10H19F3N2O |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | (2S)-2-amino-N-butyl-N-(2,2,2-trifluoroethyl)butanamide |
| SMILES | CCCCN(CC(F)(F)F)C(=O)[C@@H](N)CC |
| InChI | InChI=1S/C10H19F3N2O/c1-3-5-6-15(7-10(11,12)13)9(16)8(14)4-2/h8H,3-7,14H2,1-2H3/t8-/m0/s1 |
| InChIKey | PTGXPTQROIZGQQ-QMMMGPOBSA-N |
| XLogP | 1.91 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |