C8H15F3N2O — CID 61146661
(2S)-2-amino-N-propyl-N-(2,2,2-trifluoroethyl)propanamide (PubChem CID 61146661) has the molecular formula C8H15F3N2O and a molecular weight of 212.21 g/mol. Its IUPAC name is (2S)-2-amino-N-propyl-N-(2,2,2-trifluoroethyl)propanamide.
| Compound Name | (2S)-2-amino-N-propyl-N-(2,2,2-trifluoroethyl)propanamide |
|---|---|
| PubChem CID | 61146661 |
| Molecular Formula | C8H15F3N2O |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | (2S)-2-amino-N-propyl-N-(2,2,2-trifluoroethyl)propanamide |
| SMILES | CCCN(CC(F)(F)F)C(=O)[C@H](C)N |
| InChI | InChI=1S/C8H15F3N2O/c1-3-4-13(5-8(9,10)11)7(14)6(2)12/h6H,3-5,12H2,1-2H3/t6-/m0/s1 |
| InChIKey | UPQJPEIXXIWWEI-LURJTMIESA-N |
| XLogP | 1.13 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |