C12H20F3NO3 — CID 116536982
3,3-dimethyl-2-[propyl(2,2,2-trifluoroethyl)carbamoyl]butanoic acid (PubChem CID 116536982) has the molecular formula C12H20F3NO3 and a molecular weight of 283.29 g/mol. Its IUPAC name is 3,3-dimethyl-2-[propyl(2,2,2-trifluoroethyl)carbamoyl]butanoic acid.
| Compound Name | 3,3-dimethyl-2-[propyl(2,2,2-trifluoroethyl)carbamoyl]butanoic acid |
|---|---|
| PubChem CID | 116536982 |
| Molecular Formula | C12H20F3NO3 |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 3,3-dimethyl-2-[propyl(2,2,2-trifluoroethyl)carbamoyl]butanoic acid |
| SMILES | CCCN(CC(F)(F)F)C(=O)C(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C12H20F3NO3/c1-5-6-16(7-12(13,14)15)9(17)8(10(18)19)11(2,3)4/h8H,5-7H2,1-4H3,(H,18,19) |
| InChIKey | ALBMDZKFVIRXMK-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|