C11H18F3NO4 — CID 107482299
2-[2-hydroxyethyl(2,2,2-trifluoroethyl)carbamoyl]-3,3-dimethylbutanoic acid (PubChem CID 107482299) has the molecular formula C11H18F3NO4 and a molecular weight of 285.26 g/mol. Its IUPAC name is 2-[2-hydroxyethyl(2,2,2-trifluoroethyl)carbamoyl]-3,3-dimethylbutanoic acid.
| Compound Name | 2-[2-hydroxyethyl(2,2,2-trifluoroethyl)carbamoyl]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 107482299 |
| Molecular Formula | C11H18F3NO4 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 2-[2-hydroxyethyl(2,2,2-trifluoroethyl)carbamoyl]-3,3-dimethylbutanoic acid |
| SMILES | CC(C)(C)C(C(=O)O)C(=O)N(CCO)CC(F)(F)F |
| InChI | InChI=1S/C11H18F3NO4/c1-10(2,3)7(9(18)19)8(17)15(4-5-16)6-11(12,13)14/h7,16H,4-6H2,1-3H3,(H,18,19) |
| InChIKey | HUOKTJRVVMXEEV-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|