C8H13F3N2O3 — CID 79258497
2-[2-aminobutanoyl(2,2,2-trifluoroethyl)amino]acetic acid (PubChem CID 79258497) has the molecular formula C8H13F3N2O3 and a molecular weight of 242.20 g/mol. Its IUPAC name is 2-[2-aminobutanoyl(2,2,2-trifluoroethyl)amino]acetic acid.
| Compound Name | 2-[2-aminobutanoyl(2,2,2-trifluoroethyl)amino]acetic acid |
|---|---|
| PubChem CID | 79258497 |
| Molecular Formula | C8H13F3N2O3 |
| Molecular Weight | 242.20 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 2-[2-aminobutanoyl(2,2,2-trifluoroethyl)amino]acetic acid |
| SMILES | CCC(N)C(=O)N(CC(=O)O)CC(F)(F)F |
| InChI | InChI=1S/C8H13F3N2O3/c1-2-5(12)7(16)13(3-6(14)15)4-8(9,10)11/h5H,2-4,12H2,1H3,(H,14,15) |
| InChIKey | FMRMADXKARXGBM-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.20 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |