C14H19F3N2O — CID 61164511
(2R)-2-amino-N-butyl-2-phenyl-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 61164511) has the molecular formula C14H19F3N2O and a molecular weight of 288.31 g/mol. Its IUPAC name is (2R)-2-amino-N-butyl-2-phenyl-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | (2R)-2-amino-N-butyl-2-phenyl-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 61164511 |
| Molecular Formula | C14H19F3N2O |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | (2R)-2-amino-N-butyl-2-phenyl-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | CCCCN(CC(F)(F)F)C(=O)[C@H](N)c1ccccc1 |
| InChI | InChI=1S/C14H19F3N2O/c1-2-3-9-19(10-14(15,16)17)13(20)12(18)11-7-5-4-6-8-11/h4-8,12H,2-3,9-10,18H2,1H3/t12-/m1/s1 |
| InChIKey | ULNIOLNEGIKXOW-GFCCVEGCSA-N |
| XLogP | 2.88 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |