C11H20F3NO3 — CID 79204341
N-(3-ethoxypropyl)-4-hydroxy-N-(2,2,2-trifluoroethyl)butanamide (PubChem CID 79204341) has the molecular formula C11H20F3NO3 and a molecular weight of 271.28 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-4-hydroxy-N-(2,2,2-trifluoroethyl)butanamide.
| Compound Name | N-(3-ethoxypropyl)-4-hydroxy-N-(2,2,2-trifluoroethyl)butanamide |
|---|---|
| PubChem CID | 79204341 |
| Molecular Formula | C11H20F3NO3 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | N-(3-ethoxypropyl)-4-hydroxy-N-(2,2,2-trifluoroethyl)butanamide |
| SMILES | CCOCCCN(CC(F)(F)F)C(=O)CCCO |
| InChI | InChI=1S/C11H20F3NO3/c1-2-18-8-4-6-15(9-11(12,13)14)10(17)5-3-7-16/h16H,2-9H2,1H3 |
| InChIKey | CVBHKPSTXQJAFX-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|