C10H18F3NO3 — CID 107483398
N-(2-hydroxyethyl)-3-propoxy-N-(2,2,2-trifluoroethyl)propanamide (PubChem CID 107483398) has the molecular formula C10H18F3NO3 and a molecular weight of 257.25 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-3-propoxy-N-(2,2,2-trifluoroethyl)propanamide.
| Compound Name | N-(2-hydroxyethyl)-3-propoxy-N-(2,2,2-trifluoroethyl)propanamide |
|---|---|
| PubChem CID | 107483398 |
| Molecular Formula | C10H18F3NO3 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | N-(2-hydroxyethyl)-3-propoxy-N-(2,2,2-trifluoroethyl)propanamide |
| SMILES | CCCOCCC(=O)N(CCO)CC(F)(F)F |
| InChI | InChI=1S/C10H18F3NO3/c1-2-6-17-7-3-9(16)14(4-5-15)8-10(11,12)13/h15H,2-8H2,1H3 |
| InChIKey | LSTCJVCVSZXBLV-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|