C10H16F3NO3 — CID 60794156
methyl 3-[butanoyl(2,2,2-trifluoroethyl)amino]propanoate (PubChem CID 60794156) has the molecular formula C10H16F3NO3 and a molecular weight of 255.24 g/mol. Its IUPAC name is methyl 3-[butanoyl(2,2,2-trifluoroethyl)amino]propanoate.
| Compound Name | methyl 3-[butanoyl(2,2,2-trifluoroethyl)amino]propanoate |
|---|---|
| PubChem CID | 60794156 |
| Molecular Formula | C10H16F3NO3 |
| Molecular Weight | 255.24 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | methyl 3-[butanoyl(2,2,2-trifluoroethyl)amino]propanoate |
| SMILES | CCCC(=O)N(CCC(=O)OC)CC(F)(F)F |
| InChI | InChI=1S/C10H16F3NO3/c1-3-4-8(15)14(7-10(11,12)13)6-5-9(16)17-2/h3-7H2,1-2H3 |
| InChIKey | UHZPLQYAVDYSMX-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.24 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |