C12H20F3NO3 — CID 60778332
ethyl 4-[butyl(2,2,2-trifluoroethyl)amino]-4-oxobutanoate (PubChem CID 60778332) has the molecular formula C12H20F3NO3 and a molecular weight of 283.29 g/mol. Its IUPAC name is ethyl 4-[butyl(2,2,2-trifluoroethyl)amino]-4-oxobutanoate.
| Compound Name | ethyl 4-[butyl(2,2,2-trifluoroethyl)amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 60778332 |
| Molecular Formula | C12H20F3NO3 |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | ethyl 4-[butyl(2,2,2-trifluoroethyl)amino]-4-oxobutanoate |
| SMILES | CCCCN(CC(F)(F)F)C(=O)CCC(=O)OCC |
| InChI | InChI=1S/C12H20F3NO3/c1-3-5-8-16(9-12(13,14)15)10(17)6-7-11(18)19-4-2/h3-9H2,1-2H3 |
| InChIKey | GGGXETUAZHOMLV-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |