C12H22F3NO — CID 78866720
N-butyl-3,3-dimethyl-N-(2,2,2-trifluoroethyl)butanamide (PubChem CID 78866720) has the molecular formula C12H22F3NO and a molecular weight of 253.31 g/mol. Its IUPAC name is N-butyl-3,3-dimethyl-N-(2,2,2-trifluoroethyl)butanamide.
| Compound Name | N-butyl-3,3-dimethyl-N-(2,2,2-trifluoroethyl)butanamide |
|---|---|
| PubChem CID | 78866720 |
| Molecular Formula | C12H22F3NO |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | N-butyl-3,3-dimethyl-N-(2,2,2-trifluoroethyl)butanamide |
| SMILES | CCCCN(CC(F)(F)F)C(=O)CC(C)(C)C |
| InChI | InChI=1S/C12H22F3NO/c1-5-6-7-16(9-12(13,14)15)10(17)8-11(2,3)4/h5-9H2,1-4H3 |
| InChIKey | KAHZIZDZFVCUGU-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |