C19H40N2O — CID 58848837
N-butyl-N-[5-(butylamino)pentyl]-3,3-dimethylbutanamide (PubChem CID 58848837) has the molecular formula C19H40N2O and a molecular weight of 312.54 g/mol. Its IUPAC name is N-butyl-N-[5-(butylamino)pentyl]-3,3-dimethylbutanamide.
| Compound Name | N-butyl-N-[5-(butylamino)pentyl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 58848837 |
| Molecular Formula | C19H40N2O |
| Molecular Weight | 312.54 g/mol |
| Exact Mass | 312.31 |
| IUPAC Name | N-butyl-N-[5-(butylamino)pentyl]-3,3-dimethylbutanamide |
| SMILES | CCCCNCCCCCN(CCCC)C(=O)CC(C)(C)C |
| InChI | InChI=1S/C19H40N2O/c1-6-8-13-20-14-11-10-12-16-21(15-9-7-2)18(22)17-19(3,4)5/h20H,6-17H2,1-5H3 |
| InChIKey | ULIWLFVNDAUBKN-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.54 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|