C19H39N3O — CID 58848104
N-butyl-3,3-dimethyl-N-[4-(4-methylpiperazin-1-yl)butyl]butanamide (PubChem CID 58848104) has the molecular formula C19H39N3O and a molecular weight of 325.54 g/mol. Its IUPAC name is N-butyl-3,3-dimethyl-N-[4-(4-methylpiperazin-1-yl)butyl]butanamide.
| Compound Name | N-butyl-3,3-dimethyl-N-[4-(4-methylpiperazin-1-yl)butyl]butanamide |
|---|---|
| PubChem CID | 58848104 |
| Molecular Formula | C19H39N3O |
| Molecular Weight | 325.54 g/mol |
| Exact Mass | 325.31 |
| IUPAC Name | N-butyl-3,3-dimethyl-N-[4-(4-methylpiperazin-1-yl)butyl]butanamide |
| SMILES | CCCCN(CCCCN1CCN(C)CC1)C(=O)CC(C)(C)C |
| InChI | InChI=1S/C19H39N3O/c1-6-7-11-22(18(23)17-19(2,3)4)12-9-8-10-21-15-13-20(5)14-16-21/h6-17H2,1-5H3 |
| InChIKey | VLJHQEPSZCGTGW-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.54 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|