C19H38N2O2 — CID 58848463
N-butyl-3,3-dimethyl-N-(5-morpholin-4-ylpentyl)butanamide (PubChem CID 58848463) has the molecular formula C19H38N2O2 and a molecular weight of 326.53 g/mol. Its IUPAC name is N-butyl-3,3-dimethyl-N-(5-morpholin-4-ylpentyl)butanamide.
| Compound Name | N-butyl-3,3-dimethyl-N-(5-morpholin-4-ylpentyl)butanamide |
|---|---|
| PubChem CID | 58848463 |
| Molecular Formula | C19H38N2O2 |
| Molecular Weight | 326.53 g/mol |
| Exact Mass | 326.29 |
| IUPAC Name | N-butyl-3,3-dimethyl-N-(5-morpholin-4-ylpentyl)butanamide |
| SMILES | CCCCN(CCCCCN1CCOCC1)C(=O)CC(C)(C)C |
| InChI | InChI=1S/C19H38N2O2/c1-5-6-11-21(18(22)17-19(2,3)4)12-9-7-8-10-20-13-15-23-16-14-20/h5-17H2,1-4H3 |
| InChIKey | SHWGZCVRSKRTNL-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.53 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|