C21H34N2O3 — CID 47798791
N-hexyl-2-(4-methoxyphenyl)-N-(2-morpholin-4-ylethyl)acetamide (PubChem CID 47798791) has the molecular formula C21H34N2O3 and a molecular weight of 362.51 g/mol. Its IUPAC name is N-hexyl-2-(4-methoxyphenyl)-N-(2-morpholin-4-ylethyl)acetamide.
| Compound Name | N-hexyl-2-(4-methoxyphenyl)-N-(2-morpholin-4-ylethyl)acetamide |
|---|---|
| PubChem CID | 47798791 |
| Molecular Formula | C21H34N2O3 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.26 |
| IUPAC Name | N-hexyl-2-(4-methoxyphenyl)-N-(2-morpholin-4-ylethyl)acetamide |
| SMILES | CCCCCCN(CCN1CCOCC1)C(=O)Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C21H34N2O3/c1-3-4-5-6-11-23(13-12-22-14-16-26-17-15-22)21(24)18-19-7-9-20(25-2)10-8-19/h7-10H,3-6,11-18H2,1-2H3 |
| InChIKey | QDVBRGCKSUZFDK-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|