C20H31N3O5 — CID 42701674
ethyl 2-[[(4-methoxyphenyl)methyl-(3-morpholin-4-ylpropyl)carbamoyl]amino]acetate (PubChem CID 42701674) has the molecular formula C20H31N3O5 and a molecular weight of 393.48 g/mol. Its IUPAC name is ethyl 2-[[(4-methoxyphenyl)methyl-(3-morpholin-4-ylpropyl)carbamoyl]amino]acetate.
| Compound Name | ethyl 2-[[(4-methoxyphenyl)methyl-(3-morpholin-4-ylpropyl)carbamoyl]amino]acetate |
|---|---|
| PubChem CID | 42701674 |
| Molecular Formula | C20H31N3O5 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | ethyl 2-[[(4-methoxyphenyl)methyl-(3-morpholin-4-ylpropyl)carbamoyl]amino]acetate |
| SMILES | CCOC(=O)CNC(=O)N(CCCN1CCOCC1)Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C20H31N3O5/c1-3-28-19(24)15-21-20(25)23(10-4-9-22-11-13-27-14-12-22)16-17-5-7-18(26-2)8-6-17/h5-8H,3-4,9-16H2,1-2H3,(H,21,25) |
| InChIKey | HROIENIHMQHJEU-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |