C29H35N3O3 — CID 42701222
3-(4-ethylphenyl)-1-(3-morpholin-4-ylpropyl)-1-[(3-phenoxyphenyl)methyl]urea (PubChem CID 42701222) has the molecular formula C29H35N3O3 and a molecular weight of 473.62 g/mol. Its IUPAC name is 3-(4-ethylphenyl)-1-(3-morpholin-4-ylpropyl)-1-[(3-phenoxyphenyl)methyl]urea.
| Compound Name | 3-(4-ethylphenyl)-1-(3-morpholin-4-ylpropyl)-1-[(3-phenoxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 42701222 |
| Molecular Formula | C29H35N3O3 |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.27 |
| IUPAC Name | 3-(4-ethylphenyl)-1-(3-morpholin-4-ylpropyl)-1-[(3-phenoxyphenyl)methyl]urea |
| SMILES | CCc1ccc(NC(=O)N(CCCN2CCOCC2)Cc2cccc(Oc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C29H35N3O3/c1-2-24-12-14-26(15-13-24)30-29(33)32(17-7-16-31-18-20-34-21-19-31)23-25-8-6-11-28(22-25)35-27-9-4-3-5-10-27/h3-6,8-15,22H,2,7,16-21,23H2,1H3,(H,30,33) |
| InChIKey | DVEFTOJJOFSUKM-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |