C30H36N2O3 — CID 42705023
4-ethyl-N-(3-morpholin-4-ylpropyl)-N-[(3-phenylmethoxyphenyl)methyl]benzamide (PubChem CID 42705023) has the molecular formula C30H36N2O3 and a molecular weight of 472.63 g/mol. Its IUPAC name is 4-ethyl-N-(3-morpholin-4-ylpropyl)-N-[(3-phenylmethoxyphenyl)methyl]benzamide.
| Compound Name | 4-ethyl-N-(3-morpholin-4-ylpropyl)-N-[(3-phenylmethoxyphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 42705023 |
| Molecular Formula | C30H36N2O3 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.27 |
| IUPAC Name | 4-ethyl-N-(3-morpholin-4-ylpropyl)-N-[(3-phenylmethoxyphenyl)methyl]benzamide |
| SMILES | CCc1ccc(C(=O)N(CCCN2CCOCC2)Cc2cccc(OCc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C30H36N2O3/c1-2-25-12-14-28(15-13-25)30(33)32(17-7-16-31-18-20-34-21-19-31)23-27-10-6-11-29(22-27)35-24-26-8-4-3-5-9-26/h3-6,8-15,22H,2,7,16-21,23-24H2,1H3 |
| InChIKey | YOVXWVPMGBXTTL-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |