C28H32FN3O3 — CID 42705031
3-(3-fluorophenyl)-1-(3-morpholin-4-ylpropyl)-1-[(3-phenylmethoxyphenyl)methyl]urea (PubChem CID 42705031) has the molecular formula C28H32FN3O3 and a molecular weight of 477.58 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-1-(3-morpholin-4-ylpropyl)-1-[(3-phenylmethoxyphenyl)methyl]urea.
| Compound Name | 3-(3-fluorophenyl)-1-(3-morpholin-4-ylpropyl)-1-[(3-phenylmethoxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 42705031 |
| Molecular Formula | C28H32FN3O3 |
| Molecular Weight | 477.58 g/mol |
| Exact Mass | 477.24 |
| IUPAC Name | 3-(3-fluorophenyl)-1-(3-morpholin-4-ylpropyl)-1-[(3-phenylmethoxyphenyl)methyl]urea |
| SMILES | O=C(Nc1cccc(F)c1)N(CCCN1CCOCC1)Cc1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C28H32FN3O3/c29-25-10-5-11-26(20-25)30-28(33)32(14-6-13-31-15-17-34-18-16-31)21-24-9-4-12-27(19-24)35-22-23-7-2-1-3-8-23/h1-5,7-12,19-20H,6,13-18,21-22H2,(H,30,33) |
| InChIKey | FDYWGSZDRTWUPV-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.58 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |