C31H37N3O5 — CID 42705029
ethyl 4-[[3-morpholin-4-ylpropyl-[(3-phenylmethoxyphenyl)methyl]carbamoyl]amino]benzoate (PubChem CID 42705029) has the molecular formula C31H37N3O5 and a molecular weight of 531.65 g/mol. Its IUPAC name is ethyl 4-[[3-morpholin-4-ylpropyl-[(3-phenylmethoxyphenyl)methyl]carbamoyl]amino]benzoate.
| Compound Name | ethyl 4-[[3-morpholin-4-ylpropyl-[(3-phenylmethoxyphenyl)methyl]carbamoyl]amino]benzoate |
|---|---|
| PubChem CID | 42705029 |
| Molecular Formula | C31H37N3O5 |
| Molecular Weight | 531.65 g/mol |
| Exact Mass | 531.27 |
| IUPAC Name | ethyl 4-[[3-morpholin-4-ylpropyl-[(3-phenylmethoxyphenyl)methyl]carbamoyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)N(CCCN2CCOCC2)Cc2cccc(OCc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C31H37N3O5/c1-2-38-30(35)27-12-14-28(15-13-27)32-31(36)34(17-7-16-33-18-20-37-21-19-33)23-26-10-6-11-29(22-26)39-24-25-8-4-3-5-9-25/h3-6,8-15,22H,2,7,16-21,23-24H2,1H3,(H,32,36) |
| InChIKey | CAOISFGZGKWLNK-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.65 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |