C23H30N4O3S — CID 4097864
ethyl 4-[[3-morpholin-4-ylpropyl(pyridin-2-ylmethyl)carbamothioyl]amino]benzoate (PubChem CID 4097864) has the molecular formula C23H30N4O3S and a molecular weight of 442.59 g/mol. Its IUPAC name is ethyl 4-[[3-morpholin-4-ylpropyl(pyridin-2-ylmethyl)carbamothioyl]amino]benzoate.
| Compound Name | ethyl 4-[[3-morpholin-4-ylpropyl(pyridin-2-ylmethyl)carbamothioyl]amino]benzoate |
|---|---|
| PubChem CID | 4097864 |
| Molecular Formula | C23H30N4O3S |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | ethyl 4-[[3-morpholin-4-ylpropyl(pyridin-2-ylmethyl)carbamothioyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=S)N(CCCN2CCOCC2)Cc2ccccn2)cc1 |
| InChI | InChI=1S/C23H30N4O3S/c1-2-30-22(28)19-7-9-20(10-8-19)25-23(31)27(18-21-6-3-4-11-24-21)13-5-12-26-14-16-29-17-15-26/h3-4,6-11H,2,5,12-18H2,1H3,(H,25,31) |
| InChIKey | XTTYLAYLZLNILA-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|