C23H28ClN3O3S — CID 44668843
methyl 4-[[(2-chlorophenyl)methyl-(3-morpholin-4-ylpropyl)carbamothioyl]amino]benzoate (PubChem CID 44668843) has the molecular formula C23H28ClN3O3S and a molecular weight of 462.02 g/mol. Its IUPAC name is methyl 4-[[(2-chlorophenyl)methyl-(3-morpholin-4-ylpropyl)carbamothioyl]amino]benzoate.
| Compound Name | methyl 4-[[(2-chlorophenyl)methyl-(3-morpholin-4-ylpropyl)carbamothioyl]amino]benzoate |
|---|---|
| PubChem CID | 44668843 |
| Molecular Formula | C23H28ClN3O3S |
| Molecular Weight | 462.02 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | methyl 4-[[(2-chlorophenyl)methyl-(3-morpholin-4-ylpropyl)carbamothioyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=S)N(CCCN2CCOCC2)Cc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C23H28ClN3O3S/c1-29-22(28)18-7-9-20(10-8-18)25-23(31)27(17-19-5-2-3-6-21(19)24)12-4-11-26-13-15-30-16-14-26/h2-3,5-10H,4,11-17H2,1H3,(H,25,31) |
| InChIKey | RYLHAQXTKBZENQ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.02 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|