C21H24Cl2FN3OS — CID 17370476
3-(3-chloro-4-fluorophenyl)-1-[(4-chlorophenyl)methyl]-1-(3-morpholin-4-ylpropyl)thiourea (PubChem CID 17370476) has the molecular formula C21H24Cl2FN3OS and a molecular weight of 456.41 g/mol. Its IUPAC name is 3-(3-chloro-4-fluorophenyl)-1-[(4-chlorophenyl)methyl]-1-(3-morpholin-4-ylpropyl)thiourea.
| Compound Name | 3-(3-chloro-4-fluorophenyl)-1-[(4-chlorophenyl)methyl]-1-(3-morpholin-4-ylpropyl)thiourea |
|---|---|
| PubChem CID | 17370476 |
| Molecular Formula | C21H24Cl2FN3OS |
| Molecular Weight | 456.41 g/mol |
| Exact Mass | 455.10 |
| IUPAC Name | 3-(3-chloro-4-fluorophenyl)-1-[(4-chlorophenyl)methyl]-1-(3-morpholin-4-ylpropyl)thiourea |
| SMILES | Fc1ccc(NC(=S)N(CCCN2CCOCC2)Cc2ccc(Cl)cc2)cc1Cl |
| InChI | InChI=1S/C21H24Cl2FN3OS/c22-17-4-2-16(3-5-17)15-27(9-1-8-26-10-12-28-13-11-26)21(29)25-18-6-7-20(24)19(23)14-18/h2-7,14H,1,8-13,15H2,(H,25,29) |
| InChIKey | NQGSBQASKGFRAE-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.41 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|