C23H30ClN3O2S — CID 4137462
3-(3-chloro-4-methylphenyl)-1-[(3-methoxyphenyl)methyl]-1-(3-morpholin-4-ylpropyl)thiourea (PubChem CID 4137462) has the molecular formula C23H30ClN3O2S and a molecular weight of 448.03 g/mol. Its IUPAC name is 3-(3-chloro-4-methylphenyl)-1-[(3-methoxyphenyl)methyl]-1-(3-morpholin-4-ylpropyl)thiourea.
| Compound Name | 3-(3-chloro-4-methylphenyl)-1-[(3-methoxyphenyl)methyl]-1-(3-morpholin-4-ylpropyl)thiourea |
|---|---|
| PubChem CID | 4137462 |
| Molecular Formula | C23H30ClN3O2S |
| Molecular Weight | 448.03 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | 3-(3-chloro-4-methylphenyl)-1-[(3-methoxyphenyl)methyl]-1-(3-morpholin-4-ylpropyl)thiourea |
| SMILES | COc1cccc(CN(CCCN2CCOCC2)C(=S)Nc2ccc(C)c(Cl)c2)c1 |
| InChI | InChI=1S/C23H30ClN3O2S/c1-18-7-8-20(16-22(18)24)25-23(30)27(10-4-9-26-11-13-29-14-12-26)17-19-5-3-6-21(15-19)28-2/h3,5-8,15-16H,4,9-14,17H2,1-2H3,(H,25,30) |
| InChIKey | DLUKTKIPVHPQCX-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 36.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.03 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|