C20H26ClN3OS2 — CID 4144896
3-(4-chloro-3-methylphenyl)-1-(3-morpholin-4-ylpropyl)-1-(thiophen-2-ylmethyl)thiourea (PubChem CID 4144896) has the molecular formula C20H26ClN3OS2 and a molecular weight of 424.04 g/mol. Its IUPAC name is 3-(4-chloro-3-methylphenyl)-1-(3-morpholin-4-ylpropyl)-1-(thiophen-2-ylmethyl)thiourea.
| Compound Name | 3-(4-chloro-3-methylphenyl)-1-(3-morpholin-4-ylpropyl)-1-(thiophen-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 4144896 |
| Molecular Formula | C20H26ClN3OS2 |
| Molecular Weight | 424.04 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | 3-(4-chloro-3-methylphenyl)-1-(3-morpholin-4-ylpropyl)-1-(thiophen-2-ylmethyl)thiourea |
| SMILES | Cc1cc(NC(=S)N(CCCN2CCOCC2)Cc2cccs2)ccc1Cl |
| InChI | InChI=1S/C20H26ClN3OS2/c1-16-14-17(5-6-19(16)21)22-20(26)24(15-18-4-2-13-27-18)8-3-7-23-9-11-25-12-10-23/h2,4-6,13-14H,3,7-12,15H2,1H3,(H,22,26) |
| InChIKey | CBXIECHYWFEJEB-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.04 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|