C21H24Cl3N3OS — CID 3628977
1-[(3-chlorophenyl)methyl]-3-(3,4-dichlorophenyl)-1-(3-morpholin-4-ylpropyl)thiourea (PubChem CID 3628977) has the molecular formula C21H24Cl3N3OS and a molecular weight of 472.87 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-3-(3,4-dichlorophenyl)-1-(3-morpholin-4-ylpropyl)thiourea.
| Compound Name | 1-[(3-chlorophenyl)methyl]-3-(3,4-dichlorophenyl)-1-(3-morpholin-4-ylpropyl)thiourea |
|---|---|
| PubChem CID | 3628977 |
| Molecular Formula | C21H24Cl3N3OS |
| Molecular Weight | 472.87 g/mol |
| Exact Mass | 471.07 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-3-(3,4-dichlorophenyl)-1-(3-morpholin-4-ylpropyl)thiourea |
| SMILES | S=C(Nc1ccc(Cl)c(Cl)c1)N(CCCN1CCOCC1)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C21H24Cl3N3OS/c22-17-4-1-3-16(13-17)15-27(8-2-7-26-9-11-28-12-10-26)21(29)25-18-5-6-19(23)20(24)14-18/h1,3-6,13-14H,2,7-12,15H2,(H,25,29) |
| InChIKey | IMZPNKNECZOANV-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.87 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|