C25H35N3OS — CID 3526312
3-(4-ethylphenyl)-1-[(4-ethylphenyl)methyl]-1-(3-morpholin-4-ylpropyl)thiourea (PubChem CID 3526312) has the molecular formula C25H35N3OS and a molecular weight of 425.64 g/mol. Its IUPAC name is 3-(4-ethylphenyl)-1-[(4-ethylphenyl)methyl]-1-(3-morpholin-4-ylpropyl)thiourea.
| Compound Name | 3-(4-ethylphenyl)-1-[(4-ethylphenyl)methyl]-1-(3-morpholin-4-ylpropyl)thiourea |
|---|---|
| PubChem CID | 3526312 |
| Molecular Formula | C25H35N3OS |
| Molecular Weight | 425.64 g/mol |
| Exact Mass | 425.25 |
| IUPAC Name | 3-(4-ethylphenyl)-1-[(4-ethylphenyl)methyl]-1-(3-morpholin-4-ylpropyl)thiourea |
| SMILES | CCc1ccc(CN(CCCN2CCOCC2)C(=S)Nc2ccc(CC)cc2)cc1 |
| InChI | InChI=1S/C25H35N3OS/c1-3-21-6-8-23(9-7-21)20-28(15-5-14-27-16-18-29-19-17-27)25(30)26-24-12-10-22(4-2)11-13-24/h6-13H,3-5,14-20H2,1-2H3,(H,26,30) |
| InChIKey | XTZLTFFSJVANNT-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.64 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|