C22H36FN3OS — CID 4662917
1-[(4-fluorophenyl)methyl]-3-heptyl-1-(3-morpholin-4-ylpropyl)thiourea (PubChem CID 4662917) has the molecular formula C22H36FN3OS and a molecular weight of 409.62 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-3-heptyl-1-(3-morpholin-4-ylpropyl)thiourea.
| Compound Name | 1-[(4-fluorophenyl)methyl]-3-heptyl-1-(3-morpholin-4-ylpropyl)thiourea |
|---|---|
| PubChem CID | 4662917 |
| Molecular Formula | C22H36FN3OS |
| Molecular Weight | 409.62 g/mol |
| Exact Mass | 409.26 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-3-heptyl-1-(3-morpholin-4-ylpropyl)thiourea |
| SMILES | CCCCCCCNC(=S)N(CCCN1CCOCC1)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C22H36FN3OS/c1-2-3-4-5-6-12-24-22(28)26(19-20-8-10-21(23)11-9-20)14-7-13-25-15-17-27-18-16-25/h8-11H,2-7,12-19H2,1H3,(H,24,28) |
| InChIKey | UUPXBYBRTCZBCO-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.62 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|